C15H21NO2S — CID 111484723
4-ethyl-N-[(4-hydroxythian-4-yl)methyl]benzamide (PubChem CID 111484723) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is 4-ethyl-N-[(4-hydroxythian-4-yl)methyl]benzamide.
| Compound Name | 4-ethyl-N-[(4-hydroxythian-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 111484723 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-ethyl-N-[(4-hydroxythian-4-yl)methyl]benzamide |
| SMILES | CCc1ccc(C(=O)NCC2(O)CCSCC2)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-2-12-3-5-13(6-4-12)14(17)16-11-15(18)7-9-19-10-8-15/h3-6,18H,2,7-11H2,1H3,(H,16,17) |
| InChIKey | WJRVVVZZDCWKIS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |