C19H29NO2S — CID 111484716
3-(4-tert-butylphenyl)-N-[(4-hydroxythian-4-yl)methyl]propanamide (PubChem CID 111484716) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[(4-hydroxythian-4-yl)methyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[(4-hydroxythian-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 111484716 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[(4-hydroxythian-4-yl)methyl]propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)NCC2(O)CCSCC2)cc1 |
| InChI | InChI=1S/C19H29NO2S/c1-18(2,3)16-7-4-15(5-8-16)6-9-17(21)20-14-19(22)10-12-23-13-11-19/h4-5,7-8,22H,6,9-14H2,1-3H3,(H,20,21) |
| InChIKey | XHDIFPMHUVEFIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |