C16H20F3NO2S — CID 111484990
N-[(4-hydroxythian-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 111484990) has the molecular formula C16H20F3NO2S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[(4-hydroxythian-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[(4-hydroxythian-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 111484990 |
| Molecular Formula | C16H20F3NO2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[(4-hydroxythian-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(C(F)(F)F)cc1)NCC1(O)CCSCC1 |
| InChI | InChI=1S/C16H20F3NO2S/c17-16(18,19)13-4-1-12(2-5-13)3-6-14(21)20-11-15(22)7-9-23-10-8-15/h1-2,4-5,22H,3,6-11H2,(H,20,21) |
| InChIKey | HXXPFYLJFDZMDZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |