C17H24BrNO2 — CID 102851764
4-(bromomethyl)-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide (PubChem CID 102851764) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide.
| Compound Name | 4-(bromomethyl)-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 102851764 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-(bromomethyl)-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)c2ccc(CBr)cc2)CC1 |
| InChI | InChI=1S/C17H24BrNO2/c1-16(2)7-9-17(21,10-8-16)12-19-15(20)14-5-3-13(11-18)4-6-14/h3-6,21H,7-12H2,1-2H3,(H,19,20) |
| InChIKey | VGLHMRQAJDEWSG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|