C16H23BrN2O2 — CID 65117591
3-amino-4-bromo-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide (PubChem CID 65117591) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 3-amino-4-bromo-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide.
| Compound Name | 3-amino-4-bromo-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 65117591 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-amino-4-bromo-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]benzamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)c2ccc(Br)c(N)c2)CC1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-15(2)5-7-16(21,8-6-15)10-19-14(20)11-3-4-12(17)13(18)9-11/h3-4,9,21H,5-8,10,18H2,1-2H3,(H,19,20) |
| InChIKey | UYWXZTHFWGAZSR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|