C10H13BrN2O2 — CID 107211110
3-amino-4-bromo-N-[(2R)-2-hydroxypropyl]benzamide (PubChem CID 107211110) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-amino-4-bromo-N-[(2R)-2-hydroxypropyl]benzamide.
| Compound Name | 3-amino-4-bromo-N-[(2R)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 107211110 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-amino-4-bromo-N-[(2R)-2-hydroxypropyl]benzamide |
| SMILES | C[C@@H](O)CNC(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C10H13BrN2O2/c1-6(14)5-13-10(15)7-2-3-8(11)9(12)4-7/h2-4,6,14H,5,12H2,1H3,(H,13,15)/t6-/m1/s1 |
| InChIKey | XNFXKAVAKDAASE-ZCFIWIBFSA-N |
| XLogP | 1.14 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|