C16H25BrN2O — CID 107813039
3-amino-4-bromo-N-(7-methyloctyl)benzamide (PubChem CID 107813039) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(7-methyloctyl)benzamide.
| Compound Name | 3-amino-4-bromo-N-(7-methyloctyl)benzamide |
|---|---|
| PubChem CID | 107813039 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-amino-4-bromo-N-(7-methyloctyl)benzamide |
| SMILES | CC(C)CCCCCCNC(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C16H25BrN2O/c1-12(2)7-5-3-4-6-10-19-16(20)13-8-9-14(17)15(18)11-13/h8-9,11-12H,3-7,10,18H2,1-2H3,(H,19,20) |
| InChIKey | KZZLOPLIVROHBW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|