C14H21ClN2O — CID 115325439
4-amino-3-chloro-N-(5-methylhexyl)benzamide (PubChem CID 115325439) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(5-methylhexyl)benzamide.
| Compound Name | 4-amino-3-chloro-N-(5-methylhexyl)benzamide |
|---|---|
| PubChem CID | 115325439 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-amino-3-chloro-N-(5-methylhexyl)benzamide |
| SMILES | CC(C)CCCCNC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10(2)5-3-4-8-17-14(18)11-6-7-13(16)12(15)9-11/h6-7,9-10H,3-5,8,16H2,1-2H3,(H,17,18) |
| InChIKey | XERPMNGADJTFGC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|