C12H15BrN2O3 — CID 114003913
methyl 4-[(3-amino-4-bromobenzoyl)amino]butanoate (PubChem CID 114003913) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is methyl 4-[(3-amino-4-bromobenzoyl)amino]butanoate.
| Compound Name | methyl 4-[(3-amino-4-bromobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 114003913 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | methyl 4-[(3-amino-4-bromobenzoyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C12H15BrN2O3/c1-18-11(16)3-2-6-15-12(17)8-4-5-9(13)10(14)7-8/h4-5,7H,2-3,6,14H2,1H3,(H,15,17) |
| InChIKey | ASNLYEUUTONUPK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|