C11H13FN2O2S — CID 111597214
2-fluoro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-4-carboxamide (PubChem CID 111597214) has the molecular formula C11H13FN2O2S and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-fluoro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 111597214 |
| Molecular Formula | C11H13FN2O2S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-fluoro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC1(O)CCSC1)c1ccnc(F)c1 |
| InChI | InChI=1S/C11H13FN2O2S/c12-9-5-8(1-3-13-9)10(15)14-6-11(16)2-4-17-7-11/h1,3,5,16H,2,4,6-7H2,(H,14,15) |
| InChIKey | HGAQOLIGNRZZLB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|