C17H17FN2O2 — CID 111110496
2-fluoro-N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]pyridine-4-carboxamide (PubChem CID 111110496) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-fluoro-N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 111110496 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-fluoro-N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC1(O)CCCc2ccccc21)c1ccnc(F)c1 |
| InChI | InChI=1S/C17H17FN2O2/c18-15-10-13(7-9-19-15)16(21)20-11-17(22)8-3-5-12-4-1-2-6-14(12)17/h1-2,4,6-7,9-10,22H,3,5,8,11H2,(H,20,21) |
| InChIKey | RCNUOIHLXDZBRB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|