C13H17ClFN3O2 — CID 119742010
N-[2-[(1-aminocyclopropanecarbonyl)amino]ethyl]-4-fluorobenzamide;hydrochloride (PubChem CID 119742010) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is N-[2-[(1-aminocyclopropanecarbonyl)amino]ethyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[2-[(1-aminocyclopropanecarbonyl)amino]ethyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119742010 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[2-[(1-aminocyclopropanecarbonyl)amino]ethyl]-4-fluorobenzamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCCNC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H16FN3O2.ClH/c14-10-3-1-9(2-4-10)11(18)16-7-8-17-12(19)13(15)5-6-13;/h1-4H,5-8,15H2,(H,16,18)(H,17,19);1H |
| InChIKey | JGYSOWAOSFSJFG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|