C8H9ClN2O4 — CID 107260877
N-(3-amino-2-hydroxy-3-oxopropyl)-5-chlorofuran-2-carboxamide (PubChem CID 107260877) has the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-5-chlorofuran-2-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 107260877 |
| Molecular Formula | C8H9ClN2O4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-chlorofuran-2-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C8H9ClN2O4/c9-6-2-1-5(15-6)8(14)11-3-4(12)7(10)13/h1-2,4,12H,3H2,(H2,10,13)(H,11,14) |
| InChIKey | URMDCDOUWHEIQR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |