C11H12Cl2N2O3 — CID 107261200
3-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-hydroxypropanamide (PubChem CID 107261200) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 3-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107261200 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O3/c12-7-2-1-6(3-8(7)13)4-10(17)15-5-9(16)11(14)18/h1-3,9,16H,4-5H2,(H2,14,18)(H,15,17) |
| InChIKey | SBGUIMBZCNCHEI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |