C11H11Cl2N3O3 — CID 47140929
2-[[2-(3,4-dichlorophenyl)acetyl]amino]propanediamide (PubChem CID 47140929) has the molecular formula C11H11Cl2N3O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenyl)acetyl]amino]propanediamide.
| Compound Name | 2-[[2-(3,4-dichlorophenyl)acetyl]amino]propanediamide |
|---|---|
| PubChem CID | 47140929 |
| Molecular Formula | C11H11Cl2N3O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenyl)acetyl]amino]propanediamide |
| SMILES | NC(=O)C(NC(=O)Cc1ccc(Cl)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C11H11Cl2N3O3/c12-6-2-1-5(3-7(6)13)4-8(17)16-9(10(14)18)11(15)19/h1-3,9H,4H2,(H2,14,18)(H2,15,19)(H,16,17) |
| InChIKey | DVCAXICKRWHXJY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|