C12H13Cl2NO4 — CID 107821775
(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 107821775) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.14 g/mol. Its IUPAC name is (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107821775 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO4/c13-8-2-1-7(5-9(8)14)6-11(17)15-10(3-4-16)12(18)19/h1-2,5,10,16H,3-4,6H2,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | PQBSDELAHFQHNV-JTQLQIEISA-N |
| XLogP | 1.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |