C14H19NO4S — CID 166317775
2-[[2-(4-ethylsulfanylphenyl)acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 166317775) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[[2-(4-ethylsulfanylphenyl)acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2-(4-ethylsulfanylphenyl)acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 166317775 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[[2-(4-ethylsulfanylphenyl)acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | CCSc1ccc(CC(=O)NC(CCO)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-2-20-11-5-3-10(4-6-11)9-13(17)15-12(7-8-16)14(18)19/h3-6,12,16H,2,7-9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | IWFRRSMUJJWDRC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |