C12H16N2O4 — CID 107825228
(2R)-2-[[2-(4-aminophenyl)acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 107825228) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107825228 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | Nc1ccc(CC(=O)N[C@H](CCO)C(=O)O)cc1 |
| InChI | InChI=1S/C12H16N2O4/c13-9-3-1-8(2-4-9)7-11(16)14-10(5-6-15)12(17)18/h1-4,10,15H,5-7,13H2,(H,14,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | STJXRRZKBNAFOK-SNVBAGLBSA-N |
| XLogP | -0.24 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|