C13H16N2O5 — CID 63307180
(2S)-2-[[2-(4-aminophenyl)acetyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63307180) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307180 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)Cc1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c1-20-12(17)7-10(13(18)19)15-11(16)6-8-2-4-9(14)5-3-8/h2-5,10H,6-7,14H2,1H3,(H,15,16)(H,18,19)/t10-/m0/s1 |
| InChIKey | SAMAHTHIRAMLNK-JTQLQIEISA-N |
| XLogP | -0.06 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|