C14H17NO6 — CID 63306930
(2S)-4-methoxy-2-[[2-(3-methoxyphenyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 63306930) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-4-methoxy-2-[[2-(3-methoxyphenyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-methoxy-2-[[2-(3-methoxyphenyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63306930 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-4-methoxy-2-[[2-(3-methoxyphenyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)Cc1cccc(OC)c1)C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-20-10-5-3-4-9(6-10)7-12(16)15-11(14(18)19)8-13(17)21-2/h3-6,11H,7-8H2,1-2H3,(H,15,16)(H,18,19)/t11-/m0/s1 |
| InChIKey | IHOPERLKYIBXQL-NSHDSACASA-N |
| XLogP | 0.37 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |