C13H14NO5- — CID 71358472
(2S)-4-methoxy-4-oxo-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 71358472) has the molecular formula C13H14NO5- and a molecular weight of 264.26 g/mol. Its IUPAC name is (2S)-4-methoxy-4-oxo-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | (2S)-4-methoxy-4-oxo-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 71358472 |
| Molecular Formula | C13H14NO5- |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (2S)-4-methoxy-4-oxo-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | COC(=O)C[C@H](NC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H15NO5/c1-19-12(16)8-10(13(17)18)14-11(15)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,15)(H,17,18)/p-1/t10-/m0/s1 |
| InChIKey | PZCMPHLHHMZLKD-JTQLQIEISA-M |
| XLogP | -0.97 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |