C13H13NO5-2 — CID 19350015
2-[(2-phenylacetyl)amino]pentanedioate (PubChem CID 19350015) has the molecular formula C13H13NO5-2 and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-[(2-phenylacetyl)amino]pentanedioate.
| Compound Name | 2-[(2-phenylacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 19350015 |
| Molecular Formula | C13H13NO5-2 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[(2-phenylacetyl)amino]pentanedioate |
| SMILES | O=C([O-])CCC(NC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H15NO5/c15-11(8-9-4-2-1-3-5-9)14-10(13(18)19)6-7-12(16)17/h1-5,10H,6-8H2,(H,14,15)(H,16,17)(H,18,19)/p-2 |
| InChIKey | PTSRBZOZSRJCKX-UHFFFAOYSA-L |
| XLogP | -2.01 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |