C22H25KN2O4 — CID 23703834
potassium 2,6-bis[(2-phenylacetyl)amino]hexanoate (PubChem CID 23703834) has the molecular formula C22H25KN2O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is potassium 2,6-bis[(2-phenylacetyl)amino]hexanoate.
| Compound Name | potassium 2,6-bis[(2-phenylacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 23703834 |
| Molecular Formula | C22H25KN2O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | potassium 2,6-bis[(2-phenylacetyl)amino]hexanoate |
| SMILES | O=C(Cc1ccccc1)NCCCCC(NC(=O)Cc1ccccc1)C(=O)[O-].[K+] |
| InChI | InChI=1S/C22H26N2O4.K/c25-20(15-17-9-3-1-4-10-17)23-14-8-7-13-19(22(27)28)24-21(26)16-18-11-5-2-6-12-18;/h1-6,9-12,19H,7-8,13-16H2,(H,23,25)(H,24,26)(H,27,28);/q;+1/p-1 |
| InChIKey | UJTFFQLFDFNNEO-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|