C21H29N3O2 — CID 69001910
N-[(5S)-5,6-diaminohexyl]-2-(4-phenylmethoxyphenyl)acetamide (PubChem CID 69001910) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[(5S)-5,6-diaminohexyl]-2-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | N-[(5S)-5,6-diaminohexyl]-2-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 69001910 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[(5S)-5,6-diaminohexyl]-2-(4-phenylmethoxyphenyl)acetamide |
| SMILES | NC[C@@H](N)CCCCNC(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29N3O2/c22-15-19(23)8-4-5-13-24-21(25)14-17-9-11-20(12-10-17)26-16-18-6-2-1-3-7-18/h1-3,6-7,9-12,19H,4-5,8,13-16,22-23H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | WGJJCLMQXRQNSP-IBGZPJMESA-N |
| XLogP | 2.38 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|