C36H40N2O4 — CID 141273853
2-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-6-[(2-phenylacetyl)amino]hexanamide (PubChem CID 141273853) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-6-[(2-phenylacetyl)amino]hexanamide.
| Compound Name | 2-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-6-[(2-phenylacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 141273853 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-6-[(2-phenylacetyl)amino]hexanamide |
| SMILES | NC(=O)C(CCCCNC(=O)Cc1ccccc1)CCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C36H40N2O4/c37-36(40)32(18-10-11-23-38-35(39)25-28-12-4-1-5-13-28)21-19-29-20-22-33(41-26-30-14-6-2-7-15-30)34(24-29)42-27-31-16-8-3-9-17-31/h1-9,12-17,20,22,24,32H,10-11,18-19,21,23,25-27H2,(H2,37,40)(H,38,39) |
| InChIKey | AYEORYVAVXWFCJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|