C31H31NO6S — CID 11082141
[2-[2-[2-(4-methoxy-3-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 11082141) has the molecular formula C31H31NO6S and a molecular weight of 545.66 g/mol. Its IUPAC name is [2-[2-[2-(4-methoxy-3-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[2-[2-(4-methoxy-3-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11082141 |
| Molecular Formula | C31H31NO6S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [2-[2-[2-(4-methoxy-3-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CCNC(=O)Cc2ccccc2OS(=O)(=O)c2ccc(C)cc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H31NO6S/c1-23-12-15-27(16-13-23)39(34,35)38-28-11-7-6-10-26(28)21-31(33)32-19-18-24-14-17-29(36-2)30(20-24)37-22-25-8-4-3-5-9-25/h3-17,20H,18-19,21-22H2,1-2H3,(H,32,33) |
| InChIKey | CNOFHDOCIURJRP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|