C39H42O8S2 — CID 161077966
(2-hydroxy-4-propylphenyl) 4-methylbenzenesulfonate;(2-phenylmethoxy-4-propylphenyl) 4-methylbenzenesulfonate (PubChem CID 161077966) has the molecular formula C39H42O8S2 and a molecular weight of 702.89 g/mol. Its IUPAC name is (2-hydroxy-4-propylphenyl) 4-methylbenzenesulfonate;(2-phenylmethoxy-4-propylphenyl) 4-methylbenzenesulfonate.
| Compound Name | (2-hydroxy-4-propylphenyl) 4-methylbenzenesulfonate;(2-phenylmethoxy-4-propylphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 161077966 |
| Molecular Formula | C39H42O8S2 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | (2-hydroxy-4-propylphenyl) 4-methylbenzenesulfonate;(2-phenylmethoxy-4-propylphenyl) 4-methylbenzenesulfonate |
| SMILES | CCCc1ccc(OS(=O)(=O)c2ccc(C)cc2)c(O)c1.CCCc1ccc(OS(=O)(=O)c2ccc(C)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24O4S.C16H18O4S/c1-3-7-19-12-15-22(23(16-19)26-17-20-8-5-4-6-9-20)27-28(24,25)21-13-10-18(2)11-14-21;1-3-4-13-7-10-16(15(17)11-13)20-21(18,19)14-8-5-12(2)6-9-14/h4-6,8-16H,3,7,17H2,1-2H3;5-11,17H,3-4H2,1-2H3 |
| InChIKey | UFNNWQKDMMJGIT-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|