C16H17NO5S — CID 2288717
[2-ethoxy-4-(hydroxyiminomethyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 2288717) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is [2-ethoxy-4-(hydroxyiminomethyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-(hydroxyiminomethyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2288717 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [2-ethoxy-4-(hydroxyiminomethyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C=NO)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO5S/c1-3-21-16-10-13(11-17-18)6-9-15(16)22-23(19,20)14-7-4-12(2)5-8-14/h4-11,18H,3H2,1-2H3 |
| InChIKey | HGDFCODWMVUDAB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|