C26H27ClN2O6S — CID 126330922
[2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126330922) has the molecular formula C26H27ClN2O6S and a molecular weight of 531.03 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126330922 |
| Molecular Formula | C26H27ClN2O6S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | [2-chloro-4-[(E)-[(3-ethoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C26H27ClN2O6S/c1-4-14-34-24-13-9-20(16-25(24)33-5-2)26(30)29-28-17-19-8-12-23(22(27)15-19)35-36(31,32)21-10-6-18(3)7-11-21/h6-13,15-17H,4-5,14H2,1-3H3,(H,29,30)/b28-17+ |
| InChIKey | VNAGJWNBIIFFFN-OGLMXYFKSA-N |
| XLogP | 5.37 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|