C26H26Cl2N2O7S — CID 126308284
[2-chloro-6-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126308284) has the molecular formula C26H26Cl2N2O7S and a molecular weight of 581.47 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-6-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126308284 |
| Molecular Formula | C26H26Cl2N2O7S |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OS(=O)(=O)c3ccc(Cl)cc3)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C26H26Cl2N2O7S/c1-4-12-36-22-11-6-18(15-23(22)34-3)26(31)30-29-16-17-13-21(28)25(24(14-17)35-5-2)37-38(32,33)20-9-7-19(27)8-10-20/h6-11,13-16H,4-5,12H2,1-3H3,(H,30,31)/b29-16+ |
| InChIKey | HOORMRINWDHVSC-MUFRIFMGSA-N |
| XLogP | 5.72 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|