C25H25ClN2O7S — CID 126316447
[4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126316447) has the molecular formula C25H25ClN2O7S and a molecular weight of 533.00 g/mol. Its IUPAC name is [4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126316447 |
| Molecular Formula | C25H25ClN2O7S |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | [4-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C25H25ClN2O7S/c1-4-33-21-13-7-18(15-24(21)34-5-2)25(29)28-27-16-17-6-12-22(23(14-17)32-3)35-36(30,31)20-10-8-19(26)9-11-20/h6-16H,4-5H2,1-3H3,(H,28,29)/b27-16+ |
| InChIKey | UCLXKJGONDHWMZ-JVWAILMASA-N |
| XLogP | 4.68 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|