C21H22N4O5S3 — CID 25251004
[2-ethoxy-4-[(E)-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 25251004) has the molecular formula C21H22N4O5S3 and a molecular weight of 506.63 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(E)-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 25251004 |
| Molecular Formula | C21H22N4O5S3 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | [2-ethoxy-4-[(E)-[[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2nnc(C)s2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22N4O5S3/c1-4-29-19-11-16(12-22-24-20(26)13-31-21-25-23-15(3)32-21)7-10-18(19)30-33(27,28)17-8-5-14(2)6-9-17/h5-12H,4,13H2,1-3H3,(H,24,26)/b22-12+ |
| InChIKey | OTHRMEULCZWQAJ-WSDLNYQXSA-N |
| XLogP | 3.56 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|