C20H24N2O3S — CID 5429358
N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 5429358) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 5429358 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CSc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C20H24N2O3S/c1-4-24-18-11-8-16(12-19(18)25-5-2)13-21-22-20(23)14-26-17-9-6-15(3)7-10-17/h6-13H,4-5,14H2,1-3H3,(H,22,23)/b21-13- |
| InChIKey | MSKZVMHNPAVFNK-BKUYFWCQSA-N |
| XLogP | 4.03 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|