C24H21Cl3N2O3S — CID 126217170
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]acetamide (PubChem CID 126217170) has the molecular formula C24H21Cl3N2O3S and a molecular weight of 523.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126217170 |
| Molecular Formula | C24H21Cl3N2O3S |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl3N2O3S/c1-2-31-23-12-16(4-10-22(23)32-14-17-3-9-20(26)21(27)11-17)13-28-29-24(30)15-33-19-7-5-18(25)6-8-19/h3-13H,2,14-15H2,1H3,(H,29,30)/b28-13- |
| InChIKey | MFGHDWBXTJSBHI-QDTIIGTASA-N |
| XLogP | 6.87 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|