C24H21ClN2O5S — CID 126222728
4-[[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126222728) has the molecular formula C24H21ClN2O5S and a molecular weight of 484.96 g/mol. Its IUPAC name is 4-[[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126222728 |
| Molecular Formula | C24H21ClN2O5S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 4-[[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H21ClN2O5S/c1-31-22-12-17(13-26-27-23(28)15-33-20-9-7-19(25)8-10-20)4-11-21(22)32-14-16-2-5-18(6-3-16)24(29)30/h2-13H,14-15H2,1H3,(H,27,28)(H,29,30)/b26-13- |
| InChIKey | JAELHLRUESHBFX-ZMFRSBBQSA-N |
| XLogP | 4.87 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|