C20H19ClN2O4S — CID 1180428
[4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] cyclopropanecarboxylate (PubChem CID 1180428) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] cyclopropanecarboxylate.
| Compound Name | [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 1180428 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] cyclopropanecarboxylate |
| SMILES | COc1cc(C=NNC(=O)CSc2ccc(Cl)cc2)ccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-26-18-10-13(2-9-17(18)27-20(25)14-3-4-14)11-22-23-19(24)12-28-16-7-5-15(21)6-8-16/h2,5-11,14H,3-4,12H2,1H3,(H,23,24) |
| InChIKey | VWRKYLJQGFEWGG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|