C19H19ClN2O5S — CID 6078379
[4-[(Z)-[3-(4-chlorophenyl)sulfanylpropanoylhydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 6078379) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is [4-[(Z)-[3-(4-chlorophenyl)sulfanylpropanoylhydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[3-(4-chlorophenyl)sulfanylpropanoylhydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 6078379 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [4-[(Z)-[3-(4-chlorophenyl)sulfanylpropanoylhydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CCSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H19ClN2O5S/c1-25-17-11-13(3-8-16(17)27-19(24)26-2)12-21-22-18(23)9-10-28-15-6-4-14(20)5-7-15/h3-8,11-12H,9-10H2,1-2H3,(H,22,23)/b21-12- |
| InChIKey | HGDZJBPGITYBPX-MTJSOVHGSA-N |
| XLogP | 4.13 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|