C20H20BrClN2O3S — CID 126191634
N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 126191634) has the molecular formula C20H20BrClN2O3S and a molecular weight of 483.82 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126191634 |
| Molecular Formula | C20H20BrClN2O3S |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)CCSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H20BrClN2O3S/c1-3-9-27-20-17(21)11-14(12-18(20)26-2)13-23-24-19(25)8-10-28-16-6-4-15(22)5-7-16/h3-7,11-13H,1,8-10H2,2H3,(H,24,25)/b23-13- |
| InChIKey | YCGXDMCBBGQXFX-QRVIBDJDSA-N |
| XLogP | 5.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|