C18H15Br2ClN2O2S — CID 126214868
2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 126214868) has the molecular formula C18H15Br2ClN2O2S and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126214868 |
| Molecular Formula | C18H15Br2ClN2O2S |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 515.89 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1c(Br)cc(/C=N/NC(=O)CSc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C18H15Br2ClN2O2S/c1-2-7-25-18-15(19)8-12(9-16(18)20)10-22-23-17(24)11-26-14-5-3-13(21)4-6-14/h2-6,8-10H,1,7,11H2,(H,23,24)/b22-10+ |
| InChIKey | DNCLXJVFFMISOL-LSHDLFTRSA-N |
| XLogP | 5.67 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|