C21H16Cl2N2OS2 — CID 126217149
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]acetamide (PubChem CID 126217149) has the molecular formula C21H16Cl2N2OS2 and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126217149 |
| Molecular Formula | C21H16Cl2N2OS2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)N/N=C\c1ccc(Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H16Cl2N2OS2/c22-16-3-9-18(10-4-16)27-14-21(26)25-24-13-15-1-7-19(8-2-15)28-20-11-5-17(23)6-12-20/h1-13H,14H2,(H,25,26)/b24-13- |
| InChIKey | LSXIANOUOPRMNO-CFRMEGHHSA-N |
| XLogP | 6.39 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|