C22H17ClN2O3S — CID 5139439
[4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 5139439) has the molecular formula C22H17ClN2O3S and a molecular weight of 424.91 g/mol. Its IUPAC name is [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5139439 |
| Molecular Formula | C22H17ClN2O3S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [4-[[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CSc1ccc(Cl)cc1)NN=Cc1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17ClN2O3S/c23-18-8-12-20(13-9-18)29-15-21(26)25-24-14-16-6-10-19(11-7-16)28-22(27)17-4-2-1-3-5-17/h1-14H,15H2,(H,25,26) |
| InChIKey | VMFFZAUPLYFGAV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|