C31H24N4O6 — CID 6088439
[4-[(Z)-[[3-[(2Z)-2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6088439) has the molecular formula C31H24N4O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is [4-[(Z)-[[3-[(2Z)-2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[3-[(2Z)-2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6088439 |
| Molecular Formula | C31H24N4O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | [4-[(Z)-[[3-[(2Z)-2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CC(=O)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24N4O6/c36-28(34-32-20-22-11-15-26(16-12-22)40-30(38)24-7-3-1-4-8-24)19-29(37)35-33-21-23-13-17-27(18-14-23)41-31(39)25-9-5-2-6-10-25/h1-18,20-21H,19H2,(H,34,36)(H,35,37)/b32-20-,33-21- |
| InChIKey | OOSFLPRVUMMRMM-DBNHBIGRSA-N |
| XLogP | 4.12 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|