C23H18IN3O4 — CID 124541241
[4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 124541241) has the molecular formula C23H18IN3O4 and a molecular weight of 527.32 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 124541241 |
| Molecular Formula | C23H18IN3O4 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CNC(=O)c1ccccc1I)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18IN3O4/c24-20-9-5-4-8-19(20)22(29)25-15-21(28)27-26-14-16-10-12-18(13-11-16)31-23(30)17-6-2-1-3-7-17/h1-14H,15H2,(H,25,29)(H,27,28)/b26-14- |
| InChIKey | RXXXFHJJEITFGH-WGARJPEWSA-N |
| XLogP | 3.39 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|