C20H22N3O4+ — CID 7330116
[4-[(Z)-[(2-morpholin-4-ium-4-ylacetyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 7330116) has the molecular formula C20H22N3O4+ and a molecular weight of 368.41 g/mol. Its IUPAC name is [4-[(Z)-[(2-morpholin-4-ium-4-ylacetyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[(2-morpholin-4-ium-4-ylacetyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 7330116 |
| Molecular Formula | C20H22N3O4+ |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [4-[(Z)-[(2-morpholin-4-ium-4-ylacetyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(C[NH+]1CCOCC1)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3O4/c24-19(15-23-10-12-26-13-11-23)22-21-14-16-6-8-18(9-7-16)27-20(25)17-4-2-1-3-5-17/h1-9,14H,10-13,15H2,(H,22,24)/p+1/b21-14- |
| InChIKey | KPZPDNNCBQMLFM-STZFKDTASA-O |
| XLogP | 0.27 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|