C13H17BrN3O2+ — CID 3458621
N-[(4-bromophenyl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide (PubChem CID 3458621) has the molecular formula C13H17BrN3O2+ and a molecular weight of 327.20 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 3458621 |
| Molecular Formula | C13H17BrN3O2+ |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide |
| SMILES | O=C(C[NH+]1CCOCC1)NN=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrN3O2/c14-12-3-1-11(2-4-12)9-15-16-13(18)10-17-5-7-19-8-6-17/h1-4,9H,5-8,10H2,(H,16,18)/p+1 |
| InChIKey | PPLKBYIQBFKCEO-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|