C22H28BrN4O3S+ — CID 6867315
2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide (PubChem CID 6867315) has the molecular formula C22H28BrN4O3S+ and a molecular weight of 508.46 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6867315 |
| Molecular Formula | C22H28BrN4O3S+ |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
| SMILES | CC(C)c1ccc(/C=N/NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27BrN4O3S/c1-17(2)19-5-3-18(4-6-19)15-24-25-22(28)16-26-11-13-27(14-12-26)31(29,30)21-9-7-20(23)8-10-21/h3-10,15,17H,11-14,16H2,1-2H3,(H,25,28)/p+1/b24-15+ |
| InChIKey | WVOUTXGEYQQHGQ-BUVRLJJBSA-O |
| XLogP | 1.61 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|