C27H37BrN4O4S — CID 3409636
4-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2,6-ditert-butylphenolate (PubChem CID 3409636) has the molecular formula C27H37BrN4O4S and a molecular weight of 593.59 g/mol. Its IUPAC name is 4-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2,6-ditert-butylphenolate.
| Compound Name | 4-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2,6-ditert-butylphenolate |
|---|---|
| PubChem CID | 3409636 |
| Molecular Formula | C27H37BrN4O4S |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 4-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2,6-ditert-butylphenolate |
| SMILES | CC(C)(C)c1cc(C=NNC(=O)C[NH+]2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)cc(C(C)(C)C)c1[O-] |
| InChI | InChI=1S/C27H37BrN4O4S/c1-26(2,3)22-15-19(16-23(25(22)34)27(4,5)6)17-29-30-24(33)18-31-11-13-32(14-12-31)37(35,36)21-9-7-20(28)8-10-21/h7-10,15-17,34H,11-14,18H2,1-6H3,(H,30,33) |
| InChIKey | PYSJQEBZVWBJSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|