C18H22BrN4O3S2+ — CID 6878998
2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 6878998) has the molecular formula C18H22BrN4O3S2+ and a molecular weight of 486.44 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6878998 |
| Molecular Formula | C18H22BrN4O3S2+ |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccsc1/C=N/NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H21BrN4O3S2/c1-14-6-11-27-17(14)12-20-21-18(24)13-22-7-9-23(10-8-22)28(25,26)16-4-2-15(19)3-5-16/h2-6,11-12H,7-10,13H2,1H3,(H,21,24)/p+1/b20-12+ |
| InChIKey | ZAKPQRQYXVKTDH-UDWIEESQSA-O |
| XLogP | 0.86 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|