C19H21BrN4O4S — CID 3595906
2-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 3595906) has the molecular formula C19H21BrN4O4S and a molecular weight of 481.37 g/mol. Its IUPAC name is 2-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 2-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 3595906 |
| Molecular Formula | C19H21BrN4O4S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 2-[[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1)NN=Cc1ccccc1[O-] |
| InChI | InChI=1S/C19H21BrN4O4S/c20-16-5-7-17(8-6-16)29(27,28)24-11-9-23(10-12-24)14-19(26)22-21-13-15-3-1-2-4-18(15)25/h1-8,13,25H,9-12,14H2,(H,22,26) |
| InChIKey | QGJUFXJDIFEJMG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|