C19H20BrN5O5S — CID 6865199
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 6865199) has the molecular formula C19H20BrN5O5S and a molecular weight of 510.37 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6865199 |
| Molecular Formula | C19H20BrN5O5S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1)N/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20BrN5O5S/c20-16-5-7-17(8-6-16)31(29,30)24-11-9-23(10-12-24)14-19(26)22-21-13-15-3-1-2-4-18(15)25(27)28/h1-8,13H,9-12,14H2,(H,22,26)/b21-13+ |
| InChIKey | QETBBGJEJJEQBV-FYJGNVAPSA-N |
| XLogP | 1.81 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|